C16H23N3O4 — CID 174950585
4-O-ethyl 1-O-(2-piperazin-1-ylethyl) 2-aminobenzene-1,4-dicarboxylate (PubChem CID 174950585) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-O-ethyl 1-O-(2-piperazin-1-ylethyl) 2-aminobenzene-1,4-dicarboxylate.
| Compound Name | 4-O-ethyl 1-O-(2-piperazin-1-ylethyl) 2-aminobenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 174950585 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-O-ethyl 1-O-(2-piperazin-1-ylethyl) 2-aminobenzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1ccc(C(=O)OCCN2CCNCC2)c(N)c1 |
| InChI | InChI=1S/C16H23N3O4/c1-2-22-15(20)12-3-4-13(14(17)11-12)16(21)23-10-9-19-7-5-18-6-8-19/h3-4,11,18H,2,5-10,17H2,1H3 |
| InChIKey | VFSPAOUZURNKFP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|