C28H40N4O4 — CID 158696483
butyl 4-piperazin-1-ylbenzoate;ethyl 4-piperazin-1-ylbenzoate (PubChem CID 158696483) has the molecular formula C28H40N4O4 and a molecular weight of 496.65 g/mol. Its IUPAC name is butyl 4-piperazin-1-ylbenzoate;ethyl 4-piperazin-1-ylbenzoate.
| Compound Name | butyl 4-piperazin-1-ylbenzoate;ethyl 4-piperazin-1-ylbenzoate |
|---|---|
| PubChem CID | 158696483 |
| Molecular Formula | C28H40N4O4 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | butyl 4-piperazin-1-ylbenzoate;ethyl 4-piperazin-1-ylbenzoate |
| SMILES | CCCCOC(=O)c1ccc(N2CCNCC2)cc1.CCOC(=O)c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C15H22N2O2.C13H18N2O2/c1-2-3-12-19-15(18)13-4-6-14(7-5-13)17-10-8-16-9-11-17;1-2-17-13(16)11-3-5-12(6-4-11)15-9-7-14-8-10-15/h4-7,16H,2-3,8-12H2,1H3;3-6,14H,2,7-10H2,1H3 |
| InChIKey | IGZXHKNJZGHPBH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|