C46H56N4O8 — CID 134540950
ethyl 4-[4,8,11-tris(4-ethoxycarbonylphenyl)-1,4,8,11-tetrazacyclotetradec-1-yl]benzoate (PubChem CID 134540950) has the molecular formula C46H56N4O8 and a molecular weight of 792.97 g/mol. Its IUPAC name is ethyl 4-[4,8,11-tris(4-ethoxycarbonylphenyl)-1,4,8,11-tetrazacyclotetradec-1-yl]benzoate.
| Compound Name | ethyl 4-[4,8,11-tris(4-ethoxycarbonylphenyl)-1,4,8,11-tetrazacyclotetradec-1-yl]benzoate |
|---|---|
| PubChem CID | 134540950 |
| Molecular Formula | C46H56N4O8 |
| Molecular Weight | 792.97 g/mol |
| Exact Mass | 792.41 |
| IUPAC Name | ethyl 4-[4,8,11-tris(4-ethoxycarbonylphenyl)-1,4,8,11-tetrazacyclotetradec-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCCN(c3ccc(C(=O)OCC)cc3)CCN(c3ccc(C(=O)OCC)cc3)CCCN(c3ccc(C(=O)OCC)cc3)CC2)cc1 |
| InChI | InChI=1S/C46H56N4O8/c1-5-55-43(51)35-11-19-39(20-12-35)47-27-9-28-49(41-23-15-37(16-24-41)45(53)57-7-3)33-34-50(42-25-17-38(18-26-42)46(54)58-8-4)30-10-29-48(32-31-47)40-21-13-36(14-22-40)44(52)56-6-2/h11-26H,5-10,27-34H2,1-4H3 |
| InChIKey | AYQPZBPCTZACHZ-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.97 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|