C20H27NO4 — CID 22730063
ethyl 4-[4-[2-(1,3-dioxan-2-yl)ethylidene]piperidin-1-yl]benzoate (PubChem CID 22730063) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is ethyl 4-[4-[2-(1,3-dioxan-2-yl)ethylidene]piperidin-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[2-(1,3-dioxan-2-yl)ethylidene]piperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 22730063 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | ethyl 4-[4-[2-(1,3-dioxan-2-yl)ethylidene]piperidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCC(=CCC3OCCCO3)CC2)cc1 |
| InChI | InChI=1S/C20H27NO4/c1-2-23-20(22)17-5-7-18(8-6-17)21-12-10-16(11-13-21)4-9-19-24-14-3-15-25-19/h4-8,19H,2-3,9-15H2,1H3 |
| InChIKey | DUZPSIALYRSATK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|