C31H40N2O2 — CID 67388908
ethyl 4-[4-[[4-[[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]phenyl]methylidene]piperidin-1-yl]benzoate (PubChem CID 67388908) has the molecular formula C31H40N2O2 and a molecular weight of 472.67 g/mol. Its IUPAC name is ethyl 4-[4-[[4-[[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]phenyl]methylidene]piperidin-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[[4-[[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]phenyl]methylidene]piperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 67388908 |
| Molecular Formula | C31H40N2O2 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | ethyl 4-[4-[[4-[[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]phenyl]methylidene]piperidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCC(=Cc3ccc(N[C@H]4C[C@H]5C[C@@H]([C@@H]4C)C5(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H40N2O2/c1-5-35-30(34)24-8-12-27(13-9-24)33-16-14-23(15-17-33)18-22-6-10-26(11-7-22)32-29-20-25-19-28(21(29)2)31(25,3)4/h6-13,18,21,25,28-29,32H,5,14-17,19-20H2,1-4H3/t21-,25+,28-,29-/m0/s1 |
| InChIKey | FVZZBPACFUKQOR-NCRQKIDHSA-N |
| XLogP | 7.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |