C13H17NO5S — CID 6556767
ethyl 4-[[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]benzoate (PubChem CID 6556767) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is ethyl 4-[[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]benzoate.
| Compound Name | ethyl 4-[[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 6556767 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | ethyl 4-[[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N[C@@H]2CS(=O)(=O)C[C@H]2O)cc1 |
| InChI | InChI=1S/C13H17NO5S/c1-2-19-13(16)9-3-5-10(6-4-9)14-11-7-20(17,18)8-12(11)15/h3-6,11-12,14-15H,2,7-8H2,1H3/t11-,12-/m1/s1 |
| InChIKey | WYNQKOYNEOMWSC-VXGBXAGGSA-N |
| XLogP | 0.43 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |