C12H16N2O4S — CID 6987651
N-[3-[[(3R,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]phenyl]acetamide (PubChem CID 6987651) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is N-[3-[[(3R,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[(3R,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 6987651 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-[3-[[(3R,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(N[C@H]2CS(=O)(=O)C[C@H]2O)c1 |
| InChI | InChI=1S/C12H16N2O4S/c1-8(15)13-9-3-2-4-10(5-9)14-11-6-19(17,18)7-12(11)16/h2-5,11-12,14,16H,6-7H2,1H3,(H,13,15)/t11-,12+/m0/s1 |
| InChIKey | GBVBKVXKTRWFOS-NWDGAFQWSA-N |
| XLogP | 0.21 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |