C15H19N3O5S — CID 108526481
N-(3-acetamidophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methyloxamide (PubChem CID 108526481) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methyloxamide.
| Compound Name | N-(3-acetamidophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methyloxamide |
|---|---|
| PubChem CID | 108526481 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-(3-acetamidophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methyloxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C(=O)N(C)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H19N3O5S/c1-10(19)16-11-4-3-5-12(8-11)17-14(20)15(21)18(2)13-6-7-24(22,23)9-13/h3-5,8,13H,6-7,9H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | KLRVBAUYIWRXQH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|