C13H13F3N2O4S — CID 108527127
N'-(1,1-dioxothiolan-3-yl)-N'-methyl-N-(2,3,4-trifluorophenyl)oxamide (PubChem CID 108527127) has the molecular formula C13H13F3N2O4S and a molecular weight of 350.32 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N'-methyl-N-(2,3,4-trifluorophenyl)oxamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N'-methyl-N-(2,3,4-trifluorophenyl)oxamide |
|---|---|
| PubChem CID | 108527127 |
| Molecular Formula | C13H13F3N2O4S |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N'-methyl-N-(2,3,4-trifluorophenyl)oxamide |
| SMILES | CN(C(=O)C(=O)Nc1ccc(F)c(F)c1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H13F3N2O4S/c1-18(7-4-5-23(21,22)6-7)13(20)12(19)17-9-3-2-8(14)10(15)11(9)16/h2-3,7H,4-6H2,1H3,(H,17,19) |
| InChIKey | JGUNYDKMYPSILO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|