C12H14ClN3O4S — CID 108520426
N-(2-chloro-3-pyridinyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methyloxamide (PubChem CID 108520426) has the molecular formula C12H14ClN3O4S and a molecular weight of 331.78 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methyloxamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methyloxamide |
|---|---|
| PubChem CID | 108520426 |
| Molecular Formula | C12H14ClN3O4S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methyloxamide |
| SMILES | CN(C(=O)C(=O)Nc1cccnc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14ClN3O4S/c1-16(8-4-6-21(19,20)7-8)12(18)11(17)15-9-3-2-5-14-10(9)13/h2-3,5,8H,4,6-7H2,1H3,(H,15,17) |
| InChIKey | UOKGGHVEHPYECQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|