C19H21N3O4S — CID 108978101
1-N'-(1,1-dioxothiolan-3-yl)-1-N'-methyl-1-N-quinolin-8-ylcyclopropane-1,1-dicarboxamide (PubChem CID 108978101) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 1-N'-(1,1-dioxothiolan-3-yl)-1-N'-methyl-1-N-quinolin-8-ylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(1,1-dioxothiolan-3-yl)-1-N'-methyl-1-N-quinolin-8-ylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108978101 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-N'-(1,1-dioxothiolan-3-yl)-1-N'-methyl-1-N-quinolin-8-ylcyclopropane-1,1-dicarboxamide |
| SMILES | CN(C(=O)C1(C(=O)Nc2cccc3cccnc23)CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21N3O4S/c1-22(14-7-11-27(25,26)12-14)18(24)19(8-9-19)17(23)21-15-6-2-4-13-5-3-10-20-16(13)15/h2-6,10,14H,7-9,11-12H2,1H3,(H,21,23) |
| InChIKey | ZFQYSZIVCDEHNX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|