C16H18F2N2O4S — CID 108978102
1-N-(2,4-difluorophenyl)-1-N'-(1,1-dioxothiolan-3-yl)-1-N'-methylcyclopropane-1,1-dicarboxamide (PubChem CID 108978102) has the molecular formula C16H18F2N2O4S and a molecular weight of 372.39 g/mol. Its IUPAC name is 1-N-(2,4-difluorophenyl)-1-N'-(1,1-dioxothiolan-3-yl)-1-N'-methylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(2,4-difluorophenyl)-1-N'-(1,1-dioxothiolan-3-yl)-1-N'-methylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108978102 |
| Molecular Formula | C16H18F2N2O4S |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-N-(2,4-difluorophenyl)-1-N'-(1,1-dioxothiolan-3-yl)-1-N'-methylcyclopropane-1,1-dicarboxamide |
| SMILES | CN(C(=O)C1(C(=O)Nc2ccc(F)cc2F)CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H18F2N2O4S/c1-20(11-4-7-25(23,24)9-11)15(22)16(5-6-16)14(21)19-13-3-2-10(17)8-12(13)18/h2-3,8,11H,4-7,9H2,1H3,(H,19,21) |
| InChIKey | MNVCSSSIOPGUJP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|