C12H14F2N2O3S — CID 47108063
3-(2,4-difluorophenyl)-1-(1,1-dioxothiolan-3-yl)-1-methylurea (PubChem CID 47108063) has the molecular formula C12H14F2N2O3S and a molecular weight of 304.32 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-(1,1-dioxothiolan-3-yl)-1-methylurea.
| Compound Name | 3-(2,4-difluorophenyl)-1-(1,1-dioxothiolan-3-yl)-1-methylurea |
|---|---|
| PubChem CID | 47108063 |
| Molecular Formula | C12H14F2N2O3S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-(1,1-dioxothiolan-3-yl)-1-methylurea |
| SMILES | CN(C(=O)Nc1ccc(F)cc1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14F2N2O3S/c1-16(9-4-5-20(18,19)7-9)12(17)15-11-3-2-8(13)6-10(11)14/h2-3,6,9H,4-5,7H2,1H3,(H,15,17) |
| InChIKey | ZEMUSYOBMSHLPT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |