C13H14F2N2O4S — CID 108985725
N-(3,4-difluorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methyloxamide (PubChem CID 108985725) has the molecular formula C13H14F2N2O4S and a molecular weight of 332.33 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methyloxamide.
| Compound Name | N-(3,4-difluorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methyloxamide |
|---|---|
| PubChem CID | 108985725 |
| Molecular Formula | C13H14F2N2O4S |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-(3,4-difluorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-methyloxamide |
| SMILES | CN(C(=O)C(=O)Nc1ccc(F)c(F)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14F2N2O4S/c1-17(9-4-5-22(20,21)7-9)13(19)12(18)16-8-2-3-10(14)11(15)6-8/h2-3,6,9H,4-5,7H2,1H3,(H,16,18) |
| InChIKey | OMEHCAZWYBNNOB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|