C16H21ClFN3O4S — CID 108527172
N-(3-chloro-4-fluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)oxamide (PubChem CID 108527172) has the molecular formula C16H21ClFN3O4S and a molecular weight of 405.88 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)oxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)oxamide |
|---|---|
| PubChem CID | 108527172 |
| Molecular Formula | C16H21ClFN3O4S |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)oxamide |
| SMILES | CN(C)CCN(C(=O)C(=O)Nc1ccc(F)c(Cl)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21ClFN3O4S/c1-20(2)6-7-21(12-5-8-26(24,25)10-12)16(23)15(22)19-11-3-4-14(18)13(17)9-11/h3-4,9,12H,5-8,10H2,1-2H3,(H,19,22) |
| InChIKey | DXEONONUCZIRJQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|