C15H20Cl2N2O3S — CID 97098518
1-butyl-3-(3,4-dichlorophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]urea (PubChem CID 97098518) has the molecular formula C15H20Cl2N2O3S and a molecular weight of 379.31 g/mol. Its IUPAC name is 1-butyl-3-(3,4-dichlorophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-butyl-3-(3,4-dichlorophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 97098518 |
| Molecular Formula | C15H20Cl2N2O3S |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 1-butyl-3-(3,4-dichlorophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]urea |
| SMILES | CCCCN(C(=O)Nc1ccc(Cl)c(Cl)c1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20Cl2N2O3S/c1-2-3-7-19(12-6-8-23(21,22)10-12)15(20)18-11-4-5-13(16)14(17)9-11/h4-5,9,12H,2-3,6-8,10H2,1H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | VREMIBRVNLUNCL-GFCCVEGCSA-N |
| XLogP | 3.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |