C14H28N2O3S — CID 97064600
1-butyl-1-[(3S)-1,1-dioxothiolan-3-yl]-3-pentylurea (PubChem CID 97064600) has the molecular formula C14H28N2O3S and a molecular weight of 304.46 g/mol. Its IUPAC name is 1-butyl-1-[(3S)-1,1-dioxothiolan-3-yl]-3-pentylurea.
| Compound Name | 1-butyl-1-[(3S)-1,1-dioxothiolan-3-yl]-3-pentylurea |
|---|---|
| PubChem CID | 97064600 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-butyl-1-[(3S)-1,1-dioxothiolan-3-yl]-3-pentylurea |
| SMILES | CCCCCNC(=O)N(CCCC)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H28N2O3S/c1-3-5-7-9-15-14(17)16(10-6-4-2)13-8-11-20(18,19)12-13/h13H,3-12H2,1-2H3,(H,15,17)/t13-/m0/s1 |
| InChIKey | VUCBVXYCSAKSHB-ZDUSSCGKSA-N |
| XLogP | 2.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|