C10H17F2NO3S — CID 103514735
N-butyl-N-(1,1-dioxothiolan-3-yl)-2,2-difluoroacetamide (PubChem CID 103514735) has the molecular formula C10H17F2NO3S and a molecular weight of 269.31 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-2,2-difluoroacetamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103514735 |
| Molecular Formula | C10H17F2NO3S |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2,2-difluoroacetamide |
| SMILES | CCCCN(C(=O)C(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17F2NO3S/c1-2-3-5-13(10(14)9(11)12)8-4-6-17(15,16)7-8/h8-9H,2-7H2,1H3 |
| InChIKey | WMCJMEGKSROELE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |