C12H24N2O4S — CID 106111983
3-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-2-methoxypropanamide (PubChem CID 106111983) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is 3-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-2-methoxypropanamide.
| Compound Name | 3-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-2-methoxypropanamide |
|---|---|
| PubChem CID | 106111983 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-2-methoxypropanamide |
| SMILES | CCCCN(C(=O)C(CN)OC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H24N2O4S/c1-3-4-6-14(12(15)11(8-13)18-2)10-5-7-19(16,17)9-10/h10-11H,3-9,13H2,1-2H3 |
| InChIKey | LTWNZGJULAPXAU-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |