C18H28N2O3S — CID 119682487
3-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-2-methyl-3-phenylpropanamide (PubChem CID 119682487) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is 3-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-2-methyl-3-phenylpropanamide.
| Compound Name | 3-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-2-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 119682487 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-2-methyl-3-phenylpropanamide |
| SMILES | CCCCN(C(=O)C(C)C(N)c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H28N2O3S/c1-3-4-11-20(16-10-12-24(22,23)13-16)18(21)14(2)17(19)15-8-6-5-7-9-15/h5-9,14,16-17H,3-4,10-13,19H2,1-2H3 |
| InChIKey | VYKSSYAQQLQGPR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |