C15H19F2NO3S — CID 18573594
N-butyl-N-(1,1-dioxothiolan-3-yl)-2,6-difluorobenzamide (PubChem CID 18573594) has the molecular formula C15H19F2NO3S and a molecular weight of 331.38 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-2,6-difluorobenzamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 18573594 |
| Molecular Formula | C15H19F2NO3S |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2,6-difluorobenzamide |
| SMILES | CCCCN(C(=O)c1c(F)cccc1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19F2NO3S/c1-2-3-8-18(11-7-9-22(20,21)10-11)15(19)14-12(16)5-4-6-13(14)17/h4-6,11H,2-3,7-10H2,1H3 |
| InChIKey | JJUMFIUAGWPSSR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |