C15H20N2O5S — CID 119179473
6-[butyl-(1,1-dioxothiolan-3-yl)carbamoyl]pyridine-2-carboxylic acid (PubChem CID 119179473) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 6-[butyl-(1,1-dioxothiolan-3-yl)carbamoyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[butyl-(1,1-dioxothiolan-3-yl)carbamoyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 119179473 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 6-[butyl-(1,1-dioxothiolan-3-yl)carbamoyl]pyridine-2-carboxylic acid |
| SMILES | CCCCN(C(=O)c1cccc(C(=O)O)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20N2O5S/c1-2-3-8-17(11-7-9-23(21,22)10-11)14(18)12-5-4-6-13(16-12)15(19)20/h4-6,11H,2-3,7-10H2,1H3,(H,19,20) |
| InChIKey | CHCGIVTZOUABKL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |