C18H22ClN3O3S — CID 55924358
N-butyl-1-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)pyrazole-3-carboxamide (PubChem CID 55924358) has the molecular formula C18H22ClN3O3S and a molecular weight of 395.91 g/mol. Its IUPAC name is N-butyl-1-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)pyrazole-3-carboxamide.
| Compound Name | N-butyl-1-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55924358 |
| Molecular Formula | C18H22ClN3O3S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-butyl-1-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)pyrazole-3-carboxamide |
| SMILES | CCCCN(C(=O)c1ccn(-c2cccc(Cl)c2)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H22ClN3O3S/c1-2-3-9-21(16-8-11-26(24,25)13-16)18(23)17-7-10-22(20-17)15-6-4-5-14(19)12-15/h4-7,10,12,16H,2-3,8-9,11,13H2,1H3 |
| InChIKey | YUGDUEQDYSRNSX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |