C12H18N2O3S2 — CID 62046166
N-butyl-N-(1,1-dioxothiolan-3-yl)-1,3-thiazole-4-carboxamide (PubChem CID 62046166) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62046166 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCCN(C(=O)c1cscn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H18N2O3S2/c1-2-3-5-14(10-4-6-19(16,17)8-10)12(15)11-7-18-9-13-11/h7,9-10H,2-6,8H2,1H3 |
| InChIKey | SUFWGYPEFKMIMK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |