C13H26N2O3S — CID 54869645
2-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-3-methylbutanamide (PubChem CID 54869645) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-3-methylbutanamide.
| Compound Name | 2-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 54869645 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-3-methylbutanamide |
| SMILES | CCCCN(C(=O)C(N)C(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H26N2O3S/c1-4-5-7-15(13(16)12(14)10(2)3)11-6-8-19(17,18)9-11/h10-12H,4-9,14H2,1-3H3 |
| InChIKey | AUAJCCSYISPTJW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |