butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid

C9H17NO2S3 — CID 51496105

IUPACbutyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid
SMILESCCCCN(C(=S)S)[C@@H]1CCS(=O)(=O)C1
InChIInChI=1S/C9H17NO2S3/c1-2-3-5-10(9(13)14)8-4-6-15(11,12)7-8/h8H,2-7H2,1H3,(H,13,14)/t8-/m1/s1
InChIKeyCRCWESIXSDXEQV-MRVPVSSYSA-N
MW267.44 g/mol
LogP1.49
Rot. Bonds4

About butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid

butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid (PubChem CID 51496105) has the molecular formula C9H17NO2S3 and a molecular weight of 267.44 g/mol. Its IUPAC name is butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid.

Molecular Properties

Compound Namebutyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid
PubChem CID51496105
Molecular FormulaC9H17NO2S3
Molecular Weight267.44 g/mol
Exact Mass267.04
IUPAC Namebutyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid
SMILESCCCCN(C(=S)S)[C@@H]1CCS(=O)(=O)C1
InChIInChI=1S/C9H17NO2S3/c1-2-3-5-10(9(13)14)8-4-6-15(11,12)7-8/h8H,2-7H2,1H3,(H,13,14)/t8-/m1/s1
InChIKeyCRCWESIXSDXEQV-MRVPVSSYSA-N
XLogP1.49
TPSA37.38 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.44
LogP ≤ 51.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid?
The IUPAC name of butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid (CID 51496105) is butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid.
What is the SMILES notation for butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid?
The canonical SMILES for butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid is CCCCN(C(=S)S)[C@@H]1CCS(=O)(=O)C1.
What is the InChIKey of butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid?
The InChIKey is CRCWESIXSDXEQV-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H17NO2S3/c1-2-3-5-10(9(13)14)8-4-6-15(11,12)7-8/h8H,2-7H2,1H3,(H,13,14)/t8-/m1/s1.
What are the key properties of butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid?
butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid has a molecular weight of 267.44 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid is sourced from PubChem (CID 51496105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).