C9H17NO2S3 — CID 51496105
butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid (PubChem CID 51496105) has the molecular formula C9H17NO2S3 and a molecular weight of 267.44 g/mol. Its IUPAC name is butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid.
| Compound Name | butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid |
|---|---|
| PubChem CID | 51496105 |
| Molecular Formula | C9H17NO2S3 |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | butyl-[(3R)-1,1-dioxothiolan-3-yl]carbamodithioic acid |
| SMILES | CCCCN(C(=S)S)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO2S3/c1-2-3-5-10(9(13)14)8-4-6-15(11,12)7-8/h8H,2-7H2,1H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | CRCWESIXSDXEQV-MRVPVSSYSA-N |
| XLogP | 1.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|