C14H26N2O4S3 — CID 4203006
1-butyl-1-(1,1-dioxothiolan-3-yl)-3-(3-methyl-1,1-dioxothiolan-3-yl)thiourea (PubChem CID 4203006) has the molecular formula C14H26N2O4S3 and a molecular weight of 382.57 g/mol. Its IUPAC name is 1-butyl-1-(1,1-dioxothiolan-3-yl)-3-(3-methyl-1,1-dioxothiolan-3-yl)thiourea.
| Compound Name | 1-butyl-1-(1,1-dioxothiolan-3-yl)-3-(3-methyl-1,1-dioxothiolan-3-yl)thiourea |
|---|---|
| PubChem CID | 4203006 |
| Molecular Formula | C14H26N2O4S3 |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-butyl-1-(1,1-dioxothiolan-3-yl)-3-(3-methyl-1,1-dioxothiolan-3-yl)thiourea |
| SMILES | CCCCN(C(=S)NC1(C)CCS(=O)(=O)C1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H26N2O4S3/c1-3-4-7-16(12-5-8-22(17,18)10-12)13(21)15-14(2)6-9-23(19,20)11-14/h12H,3-11H2,1-2H3,(H,15,21) |
| InChIKey | QKFQSSFAYFRBSV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|