C17H24N2O4S2 — CID 8785848
3-(1,3-benzodioxol-5-ylmethyl)-1-butyl-1-[(3R)-1,1-dioxothiolan-3-yl]thiourea (PubChem CID 8785848) has the molecular formula C17H24N2O4S2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-1-butyl-1-[(3R)-1,1-dioxothiolan-3-yl]thiourea.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-1-butyl-1-[(3R)-1,1-dioxothiolan-3-yl]thiourea |
|---|---|
| PubChem CID | 8785848 |
| Molecular Formula | C17H24N2O4S2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-1-butyl-1-[(3R)-1,1-dioxothiolan-3-yl]thiourea |
| SMILES | CCCCN(C(=S)NCc1ccc2c(c1)OCO2)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24N2O4S2/c1-2-3-7-19(14-6-8-25(20,21)11-14)17(24)18-10-13-4-5-15-16(9-13)23-12-22-15/h4-5,9,14H,2-3,6-8,10-12H2,1H3,(H,18,24)/t14-/m1/s1 |
| InChIKey | LAYQKJDQDNSBSK-CQSZACIVSA-N |
| XLogP | 2.08 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|