C17H26N2O4S2 — CID 9098090
1-[(3R)-1,1-dioxothiolan-3-yl]-3-[(4-methoxyphenyl)methyl]-1-(3-methoxypropyl)thiourea (PubChem CID 9098090) has the molecular formula C17H26N2O4S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[(4-methoxyphenyl)methyl]-1-(3-methoxypropyl)thiourea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[(4-methoxyphenyl)methyl]-1-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 9098090 |
| Molecular Formula | C17H26N2O4S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[(4-methoxyphenyl)methyl]-1-(3-methoxypropyl)thiourea |
| SMILES | COCCCN(C(=S)NCc1ccc(OC)cc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H26N2O4S2/c1-22-10-3-9-19(15-8-11-25(20,21)13-15)17(24)18-12-14-4-6-16(23-2)7-5-14/h4-7,15H,3,8-13H2,1-2H3,(H,18,24)/t15-/m1/s1 |
| InChIKey | UOPDMPJDLDVPIE-OAHLLOKOSA-N |
| XLogP | 1.60 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|