C15H22N2O3S2 — CID 9231459
1-[(3S)-1,1-dioxothiolan-3-yl]-3-ethyl-1-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 9231459) has the molecular formula C15H22N2O3S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-ethyl-1-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-ethyl-1-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 9231459 |
| Molecular Formula | C15H22N2O3S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-ethyl-1-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | CCNC(=S)N(Cc1ccc(OC)cc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H22N2O3S2/c1-3-16-15(21)17(13-8-9-22(18,19)11-13)10-12-4-6-14(20-2)7-5-12/h4-7,13H,3,8-11H2,1-2H3,(H,16,21)/t13-/m0/s1 |
| InChIKey | ZDEMBEBBONQETL-ZDUSSCGKSA-N |
| XLogP | 1.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|