C21H27N3O3S2 — CID 18883856
1-[[4-(dimethylamino)phenyl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-(4-methoxyphenyl)thiourea (PubChem CID 18883856) has the molecular formula C21H27N3O3S2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 18883856 |
| Molecular Formula | C21H27N3O3S2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(Cc2ccc(N(C)C)cc2)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H27N3O3S2/c1-23(2)18-8-4-16(5-9-18)14-24(19-12-13-29(25,26)15-19)21(28)22-17-6-10-20(27-3)11-7-17/h4-11,19H,12-15H2,1-3H3,(H,22,28) |
| InChIKey | STZLJUKKNAQXJZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|