C18H19N3O4S2 — CID 8655216
1-benzyl-1-[(3S)-1,1-dioxothiolan-3-yl]-3-(4-nitrophenyl)thiourea (PubChem CID 8655216) has the molecular formula C18H19N3O4S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-benzyl-1-[(3S)-1,1-dioxothiolan-3-yl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-benzyl-1-[(3S)-1,1-dioxothiolan-3-yl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 8655216 |
| Molecular Formula | C18H19N3O4S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 1-benzyl-1-[(3S)-1,1-dioxothiolan-3-yl]-3-(4-nitrophenyl)thiourea |
| SMILES | O=[N+]([O-])c1ccc(NC(=S)N(Cc2ccccc2)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C18H19N3O4S2/c22-21(23)16-8-6-15(7-9-16)19-18(26)20(12-14-4-2-1-3-5-14)17-10-11-27(24,25)13-17/h1-9,17H,10-13H2,(H,19,26)/t17-/m0/s1 |
| InChIKey | OESVXTIZQOVZGW-KRWDZBQOSA-N |
| XLogP | 2.98 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|