C18H28N2O2S2 — CID 8683147
1-[(3S)-1,1-dioxothiolan-3-yl]-1-(2-methylpropyl)-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 8683147) has the molecular formula C18H28N2O2S2 and a molecular weight of 368.57 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-1-(2-methylpropyl)-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-1-(2-methylpropyl)-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 8683147 |
| Molecular Formula | C18H28N2O2S2 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-1-(2-methylpropyl)-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)CN(C(=S)Nc1ccc(C(C)C)cc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H28N2O2S2/c1-13(2)11-20(17-9-10-24(21,22)12-17)18(23)19-16-7-5-15(6-8-16)14(3)4/h5-8,13-14,17H,9-12H2,1-4H3,(H,19,23)/t17-/m0/s1 |
| InChIKey | PWCHKVNGABWFLF-KRWDZBQOSA-N |
| XLogP | 3.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|