C13H23ClN2O4S3 — CID 3656595
3-(4-chloro-1,1-dioxothiolan-3-yl)-1-(1,1-dioxothiolan-3-yl)-1-(2-methylpropyl)thiourea (PubChem CID 3656595) has the molecular formula C13H23ClN2O4S3 and a molecular weight of 402.99 g/mol. Its IUPAC name is 3-(4-chloro-1,1-dioxothiolan-3-yl)-1-(1,1-dioxothiolan-3-yl)-1-(2-methylpropyl)thiourea.
| Compound Name | 3-(4-chloro-1,1-dioxothiolan-3-yl)-1-(1,1-dioxothiolan-3-yl)-1-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 3656595 |
| Molecular Formula | C13H23ClN2O4S3 |
| Molecular Weight | 402.99 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 3-(4-chloro-1,1-dioxothiolan-3-yl)-1-(1,1-dioxothiolan-3-yl)-1-(2-methylpropyl)thiourea |
| SMILES | CC(C)CN(C(=S)NC1CS(=O)(=O)CC1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H23ClN2O4S3/c1-9(2)5-16(10-3-4-22(17,18)6-10)13(21)15-12-8-23(19,20)7-11(12)14/h9-12H,3-8H2,1-2H3,(H,15,21) |
| InChIKey | SCHBXOUXHCTVBL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.99 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|