C15H20ClNO3S — CID 18573583
3-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)benzamide (PubChem CID 18573583) has the molecular formula C15H20ClNO3S and a molecular weight of 329.85 g/mol. Its IUPAC name is 3-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)benzamide.
| Compound Name | 3-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 18573583 |
| Molecular Formula | C15H20ClNO3S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-chloro-N-(1,1-dioxothiolan-3-yl)-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(C(=O)c1cccc(Cl)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20ClNO3S/c1-11(2)9-17(14-6-7-21(19,20)10-14)15(18)12-4-3-5-13(16)8-12/h3-5,8,11,14H,6-7,9-10H2,1-2H3 |
| InChIKey | CCHLIIMJMKVVKB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |