C18H21ClN2O3S — CID 39902798
2-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)quinoline-4-carboxamide (PubChem CID 39902798) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is 2-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)quinoline-4-carboxamide.
| Compound Name | 2-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 39902798 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-N-(2-methylpropyl)quinoline-4-carboxamide |
| SMILES | CC(C)CN(C(=O)c1cc(Cl)nc2ccccc12)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H21ClN2O3S/c1-12(2)10-21(13-7-8-25(23,24)11-13)18(22)15-9-17(19)20-16-6-4-3-5-14(15)16/h3-6,9,12-13H,7-8,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | LEHBPBGRLLBWPJ-CYBMUJFWSA-N |
| XLogP | 3.17 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|