C18H17Cl2NO3S — CID 3708910
3-chloro-N-[(4-chlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)benzamide (PubChem CID 3708910) has the molecular formula C18H17Cl2NO3S and a molecular weight of 398.31 g/mol. Its IUPAC name is 3-chloro-N-[(4-chlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 3-chloro-N-[(4-chlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 3708910 |
| Molecular Formula | C18H17Cl2NO3S |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 3-chloro-N-[(4-chlorophenyl)methyl]-N-(1,1-dioxothiolan-3-yl)benzamide |
| SMILES | O=C(c1cccc(Cl)c1)N(Cc1ccc(Cl)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H17Cl2NO3S/c19-15-6-4-13(5-7-15)11-21(17-8-9-25(23,24)12-17)18(22)14-2-1-3-16(20)10-14/h1-7,10,17H,8-9,11-12H2 |
| InChIKey | IEAUKUYKFDZLMB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |