C18H17Cl2NO3S — CID 8781845
N-benzyl-3,4-dichloro-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 8781845) has the molecular formula C18H17Cl2NO3S and a molecular weight of 398.31 g/mol. Its IUPAC name is N-benzyl-3,4-dichloro-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | N-benzyl-3,4-dichloro-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 8781845 |
| Molecular Formula | C18H17Cl2NO3S |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | N-benzyl-3,4-dichloro-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N(Cc1ccccc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H17Cl2NO3S/c19-16-7-6-14(10-17(16)20)18(22)21(11-13-4-2-1-3-5-13)15-8-9-25(23,24)12-15/h1-7,10,15H,8-9,11-12H2/t15-/m1/s1 |
| InChIKey | APFZTLLSVJMEAB-OAHLLOKOSA-N |
| XLogP | 3.82 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |