C8H15ClN2O2S2 — CID 3262753
1-(4-chloro-1,1-dioxothiolan-3-yl)-3-propan-2-ylthiourea (PubChem CID 3262753) has the molecular formula C8H15ClN2O2S2 and a molecular weight of 270.81 g/mol. Its IUPAC name is 1-(4-chloro-1,1-dioxothiolan-3-yl)-3-propan-2-ylthiourea.
| Compound Name | 1-(4-chloro-1,1-dioxothiolan-3-yl)-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 3262753 |
| Molecular Formula | C8H15ClN2O2S2 |
| Molecular Weight | 270.81 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 1-(4-chloro-1,1-dioxothiolan-3-yl)-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C8H15ClN2O2S2/c1-5(2)10-8(14)11-7-4-15(12,13)3-6(7)9/h5-7H,3-4H2,1-2H3,(H2,10,11,14) |
| InChIKey | VOCJCDFCIBNBJQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.81 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|