C8H12Cl3NO3S2 — CID 43828089
O-(1,3-dichloropropan-2-yl) N-(4-chloro-1,1-dioxothiolan-3-yl)carbamothioate (PubChem CID 43828089) has the molecular formula C8H12Cl3NO3S2 and a molecular weight of 340.68 g/mol. Its IUPAC name is O-(1,3-dichloropropan-2-yl) N-(4-chloro-1,1-dioxothiolan-3-yl)carbamothioate.
| Compound Name | O-(1,3-dichloropropan-2-yl) N-(4-chloro-1,1-dioxothiolan-3-yl)carbamothioate |
|---|---|
| PubChem CID | 43828089 |
| Molecular Formula | C8H12Cl3NO3S2 |
| Molecular Weight | 340.68 g/mol |
| Exact Mass | 338.93 |
| IUPAC Name | O-(1,3-dichloropropan-2-yl) N-(4-chloro-1,1-dioxothiolan-3-yl)carbamothioate |
| SMILES | O=S1(=O)CC(Cl)C(NC(=S)OC(CCl)CCl)C1 |
| InChI | InChI=1S/C8H12Cl3NO3S2/c9-1-5(2-10)15-8(16)12-7-4-17(13,14)3-6(7)11/h5-7H,1-4H2,(H,12,16) |
| InChIKey | KPERORHPYMECFR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.68 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|