C15H28ClNO3S2 — CID 43828264
O-decyl N-(4-chloro-1,1-dioxothiolan-3-yl)carbamothioate (PubChem CID 43828264) has the molecular formula C15H28ClNO3S2 and a molecular weight of 369.98 g/mol. Its IUPAC name is O-decyl N-(4-chloro-1,1-dioxothiolan-3-yl)carbamothioate.
| Compound Name | O-decyl N-(4-chloro-1,1-dioxothiolan-3-yl)carbamothioate |
|---|---|
| PubChem CID | 43828264 |
| Molecular Formula | C15H28ClNO3S2 |
| Molecular Weight | 369.98 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | O-decyl N-(4-chloro-1,1-dioxothiolan-3-yl)carbamothioate |
| SMILES | CCCCCCCCCCOC(=S)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C15H28ClNO3S2/c1-2-3-4-5-6-7-8-9-10-20-15(21)17-14-12-22(18,19)11-13(14)16/h13-14H,2-12H2,1H3,(H,17,21) |
| InChIKey | DGJRZLHDBVKWHQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.98 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|