C13H23NO3S2 — CID 43828188
O-octyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamothioate (PubChem CID 43828188) has the molecular formula C13H23NO3S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is O-octyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamothioate.
| Compound Name | O-octyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamothioate |
|---|---|
| PubChem CID | 43828188 |
| Molecular Formula | C13H23NO3S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | O-octyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamothioate |
| SMILES | CCCCCCCCOC(=S)NC1=CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H23NO3S2/c1-2-3-4-5-6-7-9-17-13(18)14-12-8-10-19(15,16)11-12/h8H,2-7,9-11H2,1H3,(H,14,18) |
| InChIKey | GCONSYKRNGEVJC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|