About heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate
heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate (PubChem CID 43828197) has the molecular formula C12H21NO2S3
and a molecular weight of 307.51 g/mol. Its IUPAC name is heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate.
Molecular Properties
| Compound Name | heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate |
| PubChem CID | 43828197 |
| Molecular Formula | C12H21NO2S3 |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate |
| SMILES | CCCCCCCSC(=S)NC1=CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H21NO2S3/c1-2-3-4-5-6-8-17-12(16)13-11-7-9-18(14,15)10-11/h7H,2-6,8-10H2,1H3,(H,13,16) |
| InChIKey | HKJZCLXVZLLWRZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate?
The IUPAC name of heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate (CID 43828197) is heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate.
What is the SMILES notation for heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate?
The canonical SMILES for heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate is CCCCCCCSC(=S)NC1=CCS(=O)(=O)C1.
What is the InChIKey of heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate?
The InChIKey is HKJZCLXVZLLWRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2S3/c1-2-3-4-5-6-8-17-12(16)13-11-7-9-18(14,15)10-11/h7H,2-6,8-10H2,1H3,(H,13,16).
What are the key properties of heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate?
heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate has a molecular weight of 307.51 g/mol, XLogP of 2.88, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate is sourced from PubChem (CID 43828197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).