C12H21NO2S3 — CID 43828197
heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate (PubChem CID 43828197) has the molecular formula C12H21NO2S3 and a molecular weight of 307.51 g/mol. Its IUPAC name is heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate.
| Compound Name | heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate |
|---|---|
| PubChem CID | 43828197 |
| Molecular Formula | C12H21NO2S3 |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | heptyl N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamodithioate |
| SMILES | CCCCCCCSC(=S)NC1=CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H21NO2S3/c1-2-3-4-5-6-8-17-12(16)13-11-7-9-18(14,15)10-11/h7H,2-6,8-10H2,1H3,(H,13,16) |
| InChIKey | HKJZCLXVZLLWRZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|