About nonyl N-phenylcarbamodithioate
nonyl N-phenylcarbamodithioate (PubChem CID 12948617) has the molecular formula C16H25NS2
and a molecular weight of 295.52 g/mol. Its IUPAC name is nonyl N-phenylcarbamodithioate.
Molecular Properties
| Compound Name | nonyl N-phenylcarbamodithioate |
| PubChem CID | 12948617 |
| Molecular Formula | C16H25NS2 |
| Molecular Weight | 295.52 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | nonyl N-phenylcarbamodithioate |
| SMILES | CCCCCCCCCSC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C16H25NS2/c1-2-3-4-5-6-7-11-14-19-16(18)17-15-12-9-8-10-13-15/h8-10,12-13H,2-7,11,14H2,1H3,(H,17,18) |
| InChIKey | WWMHHLTXVCUWTC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze nonyl N-phenylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonyl N-phenylcarbamodithioate?
The IUPAC name of nonyl N-phenylcarbamodithioate (CID 12948617) is nonyl N-phenylcarbamodithioate.
What is the SMILES notation for nonyl N-phenylcarbamodithioate?
The canonical SMILES for nonyl N-phenylcarbamodithioate is CCCCCCCCCSC(=S)Nc1ccccc1.
What is the InChIKey of nonyl N-phenylcarbamodithioate?
The InChIKey is WWMHHLTXVCUWTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NS2/c1-2-3-4-5-6-7-11-14-19-16(18)17-15-12-9-8-10-13-15/h8-10,12-13H,2-7,11,14H2,1H3,(H,17,18).
What are the key properties of nonyl N-phenylcarbamodithioate?
nonyl N-phenylcarbamodithioate has a molecular weight of 295.52 g/mol, XLogP of 5.87, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonyl N-phenylcarbamodithioate is sourced from PubChem (CID 12948617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).