About S-decyl benzenecarbothioate
S-decyl benzenecarbothioate (PubChem CID 11616108) has the molecular formula C17H26OS
and a molecular weight of 278.46 g/mol. Its IUPAC name is S-decyl benzenecarbothioate.
Molecular Properties
| Compound Name | S-decyl benzenecarbothioate |
| PubChem CID | 11616108 |
| Molecular Formula | C17H26OS |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | S-decyl benzenecarbothioate |
| SMILES | CCCCCCCCCCSC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H26OS/c1-2-3-4-5-6-7-8-12-15-19-17(18)16-13-10-9-11-14-16/h9-11,13-14H,2-8,12,15H2,1H3 |
| InChIKey | DOUFIPAKOOOUTB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-decyl benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-decyl benzenecarbothioate?
The IUPAC name of S-decyl benzenecarbothioate (CID 11616108) is S-decyl benzenecarbothioate.
What is the SMILES notation for S-decyl benzenecarbothioate?
The canonical SMILES for S-decyl benzenecarbothioate is CCCCCCCCCCSC(=O)c1ccccc1.
What is the InChIKey of S-decyl benzenecarbothioate?
The InChIKey is DOUFIPAKOOOUTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26OS/c1-2-3-4-5-6-7-8-12-15-19-17(18)16-13-10-9-11-14-16/h9-11,13-14H,2-8,12,15H2,1H3.
What are the key properties of S-decyl benzenecarbothioate?
S-decyl benzenecarbothioate has a molecular weight of 278.46 g/mol, XLogP of 5.70, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-decyl benzenecarbothioate is sourced from PubChem (CID 11616108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).