C13H16N2O2S — CID 10084177
S-pentyl 2-oxo-1,3-dihydrobenzimidazole-5-carbothioate (PubChem CID 10084177) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is S-pentyl 2-oxo-1,3-dihydrobenzimidazole-5-carbothioate.
| Compound Name | S-pentyl 2-oxo-1,3-dihydrobenzimidazole-5-carbothioate |
|---|---|
| PubChem CID | 10084177 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | S-pentyl 2-oxo-1,3-dihydrobenzimidazole-5-carbothioate |
| SMILES | CCCCCSC(=O)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H16N2O2S/c1-2-3-4-7-18-12(16)9-5-6-10-11(8-9)15-13(17)14-10/h5-6,8H,2-4,7H2,1H3,(H2,14,15,17) |
| InChIKey | JEFUBPCYVCYIOW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|