About S-butyl 4-(trifluoromethyl)benzenecarbothioate
S-butyl 4-(trifluoromethyl)benzenecarbothioate (PubChem CID 122382217) has the molecular formula C12H13F3OS
and a molecular weight of 262.30 g/mol. Its IUPAC name is S-butyl 4-(trifluoromethyl)benzenecarbothioate.
Molecular Properties
| Compound Name | S-butyl 4-(trifluoromethyl)benzenecarbothioate |
| PubChem CID | 122382217 |
| Molecular Formula | C12H13F3OS |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | S-butyl 4-(trifluoromethyl)benzenecarbothioate |
| SMILES | CCCCSC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3OS/c1-2-3-8-17-11(16)9-4-6-10(7-5-9)12(13,14)15/h4-7H,2-3,8H2,1H3 |
| InChIKey | BAXYNQUFSDWDRR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-butyl 4-(trifluoromethyl)benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-butyl 4-(trifluoromethyl)benzenecarbothioate?
The IUPAC name of S-butyl 4-(trifluoromethyl)benzenecarbothioate (CID 122382217) is S-butyl 4-(trifluoromethyl)benzenecarbothioate.
What is the SMILES notation for S-butyl 4-(trifluoromethyl)benzenecarbothioate?
The canonical SMILES for S-butyl 4-(trifluoromethyl)benzenecarbothioate is CCCCSC(=O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of S-butyl 4-(trifluoromethyl)benzenecarbothioate?
The InChIKey is BAXYNQUFSDWDRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3OS/c1-2-3-8-17-11(16)9-4-6-10(7-5-9)12(13,14)15/h4-7H,2-3,8H2,1H3.
What are the key properties of S-butyl 4-(trifluoromethyl)benzenecarbothioate?
S-butyl 4-(trifluoromethyl)benzenecarbothioate has a molecular weight of 262.30 g/mol, XLogP of 4.38, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-butyl 4-(trifluoromethyl)benzenecarbothioate is sourced from PubChem (CID 122382217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).