About S-heptyl N-phenylcarbamothioate
S-heptyl N-phenylcarbamothioate (PubChem CID 118643411) has the molecular formula C14H21NOS
and a molecular weight of 251.40 g/mol. Its IUPAC name is S-heptyl N-phenylcarbamothioate.
Molecular Properties
| Compound Name | S-heptyl N-phenylcarbamothioate |
| PubChem CID | 118643411 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | S-heptyl N-phenylcarbamothioate |
| SMILES | CCCCCCCSC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H21NOS/c1-2-3-4-5-9-12-17-14(16)15-13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12H2,1H3,(H,15,16) |
| InChIKey | CUDDGEBPOREORJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-heptyl N-phenylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-heptyl N-phenylcarbamothioate?
The IUPAC name of S-heptyl N-phenylcarbamothioate (CID 118643411) is S-heptyl N-phenylcarbamothioate.
What is the SMILES notation for S-heptyl N-phenylcarbamothioate?
The canonical SMILES for S-heptyl N-phenylcarbamothioate is CCCCCCCSC(=O)Nc1ccccc1.
What is the InChIKey of S-heptyl N-phenylcarbamothioate?
The InChIKey is CUDDGEBPOREORJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NOS/c1-2-3-4-5-9-12-17-14(16)15-13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12H2,1H3,(H,15,16).
What are the key properties of S-heptyl N-phenylcarbamothioate?
S-heptyl N-phenylcarbamothioate has a molecular weight of 251.40 g/mol, XLogP of 4.92, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-heptyl N-phenylcarbamothioate is sourced from PubChem (CID 118643411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).