About N-phenyldec-2-enamide
N-phenyldec-2-enamide (PubChem CID 72974313) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is N-phenyldec-2-enamide.
Molecular Properties
| Compound Name | N-phenyldec-2-enamide |
| PubChem CID | 72974313 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N-phenyldec-2-enamide |
| SMILES | CCCCCCCC=CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H23NO/c1-2-3-4-5-6-7-11-14-16(18)17-15-12-9-8-10-13-15/h8-14H,2-7H2,1H3,(H,17,18) |
| InChIKey | YOZFJLYRZHILTP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-phenyldec-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyldec-2-enamide?
The IUPAC name of N-phenyldec-2-enamide (CID 72974313) is N-phenyldec-2-enamide.
What is the SMILES notation for N-phenyldec-2-enamide?
The canonical SMILES for N-phenyldec-2-enamide is CCCCCCCC=CC(=O)Nc1ccccc1.
What is the InChIKey of N-phenyldec-2-enamide?
The InChIKey is YOZFJLYRZHILTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO/c1-2-3-4-5-6-7-11-14-16(18)17-15-12-9-8-10-13-15/h8-14H,2-7H2,1H3,(H,17,18).
What are the key properties of N-phenyldec-2-enamide?
N-phenyldec-2-enamide has a molecular weight of 245.37 g/mol, XLogP of 4.54, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyldec-2-enamide is sourced from PubChem (CID 72974313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).