About heptyl N-phenylcarbamodithioate
heptyl N-phenylcarbamodithioate (PubChem CID 86226187) has the molecular formula C14H21NS2
and a molecular weight of 267.46 g/mol. Its IUPAC name is heptyl N-phenylcarbamodithioate.
Molecular Properties
| Compound Name | heptyl N-phenylcarbamodithioate |
| PubChem CID | 86226187 |
| Molecular Formula | C14H21NS2 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | heptyl N-phenylcarbamodithioate |
| SMILES | CCCCCCCSC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C14H21NS2/c1-2-3-4-5-9-12-17-14(16)15-13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12H2,1H3,(H,15,16) |
| InChIKey | XSHVFLIZOMUILD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze heptyl N-phenylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl N-phenylcarbamodithioate?
The IUPAC name of heptyl N-phenylcarbamodithioate (CID 86226187) is heptyl N-phenylcarbamodithioate.
What is the SMILES notation for heptyl N-phenylcarbamodithioate?
The canonical SMILES for heptyl N-phenylcarbamodithioate is CCCCCCCSC(=S)Nc1ccccc1.
What is the InChIKey of heptyl N-phenylcarbamodithioate?
The InChIKey is XSHVFLIZOMUILD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NS2/c1-2-3-4-5-9-12-17-14(16)15-13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12H2,1H3,(H,15,16).
What are the key properties of heptyl N-phenylcarbamodithioate?
heptyl N-phenylcarbamodithioate has a molecular weight of 267.46 g/mol, XLogP of 5.09, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl N-phenylcarbamodithioate is sourced from PubChem (CID 86226187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).